
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| XIFAXAN | Salix Pharmaceuticals | N-021361 RX | 2004-05-25 | 2 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| xifaxan | New Drug Application | 2025-08-27 |
Indication | Ontology | MeSH | ICD-10 |
|---|---|---|---|
| irritable bowel syndrome | EFO_0000555 | D043183 | K58 |
| diarrhea | — | D003967 | R19.7 |
| bacterial infections | — | D001424 | A49 |
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Rifaximin, Xifaxan, Salix Pharms | |||
| 8642573 | 2029-10-02 | U-1481 | |
| 8969398 | 2029-10-02 | U-1481 | |
| 7928115 | 2029-07-24 | U-1121 | |
| 8829017 | 2029-07-24 | U-1562 | |
| 8946252 | 2029-07-24 | U-1481 | |
| 9421195 | 2029-07-24 | U-1481 | |
| 9629828 | 2029-07-24 | U-1994 | |
| 10314828 | 2029-07-24 | U-1481 | |
| 10335397 | 2029-07-24 | U-2579 | |
| 10709694 | 2029-07-24 | U-2579 | |
| 8309569 | 2029-07-18 | U-1707, U-1708 | |
| 10456384 | 2029-02-26 | U-2643, U-2644 | |
| 10765667 | 2029-02-26 | U-2643, U-2644 | |
| 11564912 | 2029-02-26 | U-3511, U-3512 | |
| 11779571 | 2029-02-26 | U-3706 | |
| 8193196 | 2027-09-02 | DS, DP | U-1707, U-1708 |
| 8518949 | 2026-02-27 | DP | |
| 8741904 | 2026-02-27 | DP | U-1526, U-1707, U-1708 |
| 9271968 | 2026-02-27 | DP | |
| 10703763 | 2026-02-27 | U-1708, U-2847, U-2848 | |
| 7906542 | 2025-06-01 | DS, DP | |
| 7915275 | 2025-02-23 | U-1707, U-1708 | |
| 7045620 | 2024-06-19 | DS, DP | |
| 7612199 | 2024-06-19 | DS, DP | |
| 7902206 | 2024-06-19 | DS, DP | |
| 8158644 | 2024-06-19 | DP | |
| 8158781 | 2024-06-19 | DP | |
| 8835452 | 2024-06-19 | DS, DP | |
| 8853231 | 2024-06-19 | DP | |

| Drug common name | Rifaximin |
| INN | rifaximin |
| Description | Rifaximin is a semisynthetic member of the class of rifamycins and non-systemic gastrointestinal site-specific broad spectrum antibiotic. Used in the treatment of traveller's diarrhoea, hepatic encephalopathy and irritable bowel syndrome. It has a role as a gastrointestinal drug, an orphan drug and an antimicrobial agent. It is a member of rifamycins, an acetate ester, a lactam, an organic heterohexacyclic compound, a macrocycle, a semisynthetic derivative and a cyclic ketal. |
| Classification | Small molecule |
| Drug class | antibiotics (rifamycin derivatives) |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c5c(nc6cc(C)ccn65)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C |
| PDB | — |
| CAS-ID | 80621-81-4 |
| RxCUI | — |
| ChEMBL ID | CHEMBL1617 |
| ChEBI ID | 75246 |
| PubChem CID | 6436173 |
| DrugBank | DB01220 |
| UNII ID | L36O5T016N (ChemIDplus, GSRS) |






