
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| MELOXICAM | Avondale Pharmaceuticals | N-021530 RX | 2004-06-01 | 1 products, RLD, RS |
| XIFYRM | Azurity | N-218395 RX | 2025-06-05 | 1 products, RLD, RS |
| QAMZOVA | Nanjing Simcere Dongyuan Pharmaceutical | N-217593 RX | 2025-04-22 | 1 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| ZYNRELEF KIT | Heron Therapeutics | N-211988 RX | 2021-05-12 | 2 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| SYMBRAVO | Axsome Therapeutics | N-215431 RX | 2025-01-30 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| meloxicam | ANDA | 2026-09-15 |
| mobic | ANDA | 2021-03-30 |
| qamzova | New Drug Application | 2026-07-16 |
| symbravo | New Drug Application | 2025-11-21 |
| trepoxicam | unapproved drug other | 2010-10-25 |
| trepoxicam-7.5 | unapproved drug other | 2011-08-01 |
| vivlodex | New Drug Application | 2021-04-30 |
| xifyrm | New Drug Application | 2025-06-18 |
| zybic | New Drug Application | 2024-10-31 |
| zynrelef | New Drug Application | 2026-04-20 |
Expiration | Code | ||
|---|---|---|---|
BUPIVACAINE / MELOXICAM, ZYNRELEF KIT, HERON THERAPS INC | |||
| 2024-05-12 | NP | ||
MELOXICAM, ANJESO, BAUDAX | |||
| 2023-02-20 | NP | ||
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Meloxicam, Anjeso, Baudax | |||
| 10881663 | 2039-03-08 | U-3038 | |
| 11458145 | 2039-03-08 | U-3318 | |
| 9974746 | 2030-05-26 | DP | |
| 10709713 | 2030-05-26 | U-2750 | |
| 11253478 | 2030-05-26 | DP | U-3318 |
| 10463673 | 2024-02-24 | DP | U-2750 |
| 10471067 | 2024-02-24 | DP | U-2750 |
| Bupivacaine / Meloxicam, Zynrelef Kit, Heron Theraps Inc | |||
| 9694079 | 2035-04-20 | DP | U-3118 |
| 9801945 | 2035-04-20 | DP | U-3118 |
| 10098957 | 2035-04-20 | U-3118 | |
| 10213510 | 2035-04-20 | DP | U-3118 |
| 10632199 | 2035-04-20 | DP | U-3118 |
| 10898575 | 2035-04-20 | DP | U-3118 |
| 10980886 | 2035-04-20 | DP | |
| 11083730 | 2035-04-20 | DP | U-3118 |
| 11083797 | 2035-04-20 | DP | U-3118 |
| 11413350 | 2035-04-20 | U-3417 | |
| 9592227 | 2034-03-13 | DP | U-3118 |
| 9744163 | 2034-03-13 | DP | |
| 9913909 | 2034-03-13 | U-3118 | |
| 10398686 | 2034-03-13 | DP | |
| 11253504 | 2034-03-13 | U-3118 | |
| Meloxicam, Vivlodex, Iceutica Operations | |||
| 9649318 | 2035-03-31 | DP | |
| 9808468 | 2035-03-31 | U-2160, U-2165 | |
| 9526734 | 2033-03-31 | DP | |
| Meloxicam, Qmiiz Odt, Tersera | |||
| 8545879 | 2030-08-31 | DP | |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Postoperative pain | D010149 | — | G89.18 | — | 1 | 5 | 1 | — | 7 |
| Drug common name | Meloxicam |
| INN | meloxicam |
| Description | Meloxicam is a benzothiazine that is piroxicam in which the pyridin-2-yl group is replaced by a 5-methyl-1,3-thiazol-2-yl group. A non-steroidal anti-inflammatory drug and selective inhibitor of COX-2, it is used particularly for the management of rheumatoid arthritis. It has a role as a non-steroidal anti-inflammatory drug, an antirheumatic drug, a cyclooxygenase 2 inhibitor and an analgesic. It is a benzothiazine, a monocarboxylic acid amide and a member of 1,3-thiazoles. |
| Classification | Small molecule |
| Drug class | anti-inflammatory agents (isoxicam type) |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)s1 |
| PDB | — |
| CAS-ID | 71125-38-7 |
| RxCUI | — |
| ChEMBL ID | CHEMBL599 |
| ChEBI ID | 6741 |
| PubChem CID | 54677470 |
| DrugBank | DB00814 |
| UNII ID | VG2QF83CGL (ChemIDplus, GSRS) |








