
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| SUBSYS | MMB Healthcare | N-202788 DISCN | 2012-01-04 | 7 products, RLD |
| DURAGESIC-100 | Johnson & Johnson | N-019813 DISCN | 1990-08-07 | 1 products, RLD |
| DURAGESIC-75 | Johnson & Johnson | N-019813 DISCN | 1990-08-07 | 1 products, RLD |
| DURAGESIC-50 | Johnson & Johnson | N-019813 DISCN | 1990-08-07 | 1 products, RLD |
| DURAGESIC-25 | Johnson & Johnson | N-019813 DISCN | 1990-08-07 | 1 products, RLD |
| DURAGESIC-12 | Johnson & Johnson | N-019813 DISCN | 2005-02-04 | 1 products, RLD |
| DURAGESIC-37 | Johnson & Johnson | N-019813 DISCN | 2018-01-24 | 1 products, RLD |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| FENTANYL CITRATE | Hikma Pharmaceuticals | N-019101 RX | 1984-07-11 | 2 products, RLD, RS |
| FENTANYL CITRATE | Hospira | N-019115 RX | 1985-01-12 | 1 products |
| SUBLIMAZE PRESERVATIVE FREE | Rising Pharmaceuticals | N-016619 RX | 1982-01-01 | 1 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| INNOVAR | Epic Pharma | N-016049 DISCN | 1982-01-01 | 1 products |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| IONSYS | The Medicines Company | N-021338 DISCN | 2006-05-22 | 1 products, RLD |
Brand Name | Status | Last Update |
|---|---|---|
| abstral | New Drug Application | 2014-11-30 |
| fentanyl | ANDA | 2026-04-07 |
| fentanyl citrate | New Drug Application | 2026-08-24 |
| fentanyl citrate, bupivacaine hcl | unapproved drug other | 2015-01-12 |
| fentanyl system | ANDA | 2026-03-02 |
| fentanyl transdermal | ANDA | 2026-04-30 |
| fentanyl transdermal system | ANDA | 2018-06-05 |
| fentanyl, bupivacaine | unapproved drug other | 2012-08-16 |
| lazanda | New Drug Application | 2021-03-31 |
| sublimaze | New Drug Application | 2012-04-30 |
Indication | Ontology | MeSH | ICD-10 |
|---|---|---|---|
| pain | EFO_0003843 | D010146 | R52 |
| psychotic disorders | — | D011618 | F20.81 |
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Fentanyl Hydrochloride, Ionsys, The Medicines Co | |||
| 9095706 | 2033-02-03 | DP | |
| 8428709 | 2032-06-11 | DP | U-736 |
| 8428708 | 2032-05-21 | U-736 | |
| 8781571 | 2032-03-31 | DP | U-736 |
| 9731121 | 2031-10-17 | DP | |
| 8301238 | 2031-09-30 | DP | |
| 9364656 | 2031-09-30 | U-736 | |
| 6975902 | 2024-04-01 | DP | |
| Fentanyl Citrate, Lazanda, Btcp Pharma | |||
| 9731869 | 2032-01-26 | DP | |
| 8216604 | 2024-10-03 | U-767 | |
| 8889176 | 2024-01-16 | U-767 | |
| 9078814 | 2024-01-08 | DP | |
| 9814705 | 2024-01-08 | DP | |
| Fentanyl, Subsys, Btcp Pharma | |||
| 8486972 | 2030-04-27 | DP | |
| 8486973 | 2030-04-27 | U-55 | |
| 8835459 | 2027-01-25 | DP | |
| 8835460 | 2027-01-25 | DP | U-55 |
| 9241935 | 2027-01-25 | DP | |
| 9289387 | 2027-01-25 | DP | U-55 |
| 9642797 | 2027-01-25 | DP | U-55 |
| 9642844 | 2027-01-25 | DP | |
| 10016403 | 2027-01-25 | DP | |
| 10610523 | 2027-01-25 | DP | |
| Fentanyl Citrate, Fentora, Cephalon | |||
| 7862832 | 2028-06-15 | DP | |
| 7862833 | 2028-06-15 | DP | |
| 8092832 | 2024-12-30 | DP | |
| 8119158 | 2024-12-30 | DP | |
| Fentanyl Citrate, Onsolis, Adalvo | |||
| 9597288 | 2027-07-23 | DP | U-767 |

| Drug common name | Fentanyl |
| INN | fentanyl |
| Description | Fentanyl is a monocarboxylic acid amide resulting from the formal condensation of the aryl amino group of N-phenyl-1-(2-phenylethyl)piperidin-4-amine with propanoic acid. It has a role as an opioid analgesic, a mu-opioid receptor agonist, an anaesthesia adjuvant, an intravenous anaesthetic, an adjuvant and an anaesthetic. It is a member of piperidines, an anilide and a monocarboxylic acid amide. |
| Classification | Small molecule |
| Drug class | Opioid |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| PDB | — |
| CAS-ID | 437-38-7 |
| RxCUI | — |
| ChEMBL ID | CHEMBL596 |
| ChEBI ID | 119915 |
| PubChem CID | 3345 |
| DrugBank | DB00813 |
| UNII ID | UF599785JZ (ChemIDplus, GSRS) |














