
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| APLENZIN | Bausch Health Companies | N-022108 RX | 2008-04-23 | 3 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| AUVELITY | Axsome Therapeutics | N-215430 RX | 2022-08-18 | 2 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| CONTRAVE | Nalpropion Pharmaceuticals | N-200063 RX | 2014-09-10 | 1 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| WELLBUTRIN XL | Bausch Health Companies | N-021515 RX | 2003-08-28 | 2 products, RLD, RS |
| WELLBUTRIN SR | GSK | N-020358 RX | 1996-10-04 | 3 products, RLD |
| FORFIVO XL | TWi Pharmaceuticals | N-022497 RX | 2011-11-10 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| aplenzin | New Drug Application | 2026-03-04 |
| appbutamone | unapproved drug other | 2011-08-08 |
| appbutamone-d | unapproved drug other | 2011-08-01 |
| auvelity | New Drug Application | 2026-05-06 |
| budeprion | ANDA | 2010-03-25 |
| bupropion | ANDA | 2026-01-01 |
| bupropion hcl | ANDA | 2025-01-22 |
| bupropion hcl er | ANDA | 2019-07-25 |
| bupropion hcl er (xl) | ANDA | 2026-03-05 |
| bupropion hcl er bupropion hydrochloride | ANDA | 2019-04-03 |
Expiration | Code | ||
|---|---|---|---|
BUPROPION HYDROCHLORIDE / DEXTROMETHORPHAN HYDROBROMIDE, AUVELITY, AXSOME | |||
| 2025-08-18 | NP | ||
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Bupropion Hydrochloride / Dextromethorphan Hydrobromide, Auvelity, Axsome | |||
| 11844797 | 2043-04-20 | U-3778 | |
| 11839612 | 2043-03-02 | U-3419 | |
| 11752144 | 2043-02-23 | U-3419 | |
| 11730706 | 2043-01-23 | U-3419 | |
| 11883373 | 2043-01-23 | U-3419 | |
| 11717518 | 2043-01-20 | U-3419 | |
| 11896563 | 2041-12-01 | U-3419 | |
| 10780064 | 2040-01-07 | U-3419 | |
| 10925842 | 2040-01-07 | U-3419 | |
| 10940124 | 2040-01-07 | U-3419 | |
| 10966942 | 2040-01-07 | U-3419 | |
| 10780066 | 2034-11-09 | U-3419 | |
| 9168234 | 2034-11-05 | U-3419 | |
| 9198905 | 2034-11-05 | U-3419 | |
| 9205083 | 2034-11-05 | U-3419 | |
| 9238032 | 2034-11-05 | U-3419 | |
| 9278095 | 2034-11-05 | U-3419 | |
| 9314462 | 2034-11-05 | U-3419 | |
| 9370513 | 2034-11-05 | U-3419 | |
| 9375429 | 2034-11-05 | U-3419 | |
| 9408815 | 2034-11-05 | U-3419 | |
| 9421176 | 2034-11-05 | U-3419 | |
| 9457023 | 2034-11-05 | U-3419 | |
| 9457025 | 2034-11-05 | U-3419 | |
| 9474731 | 2034-11-05 | U-3419 | |
| 9486450 | 2034-11-05 | U-3419 | |
| 9700528 | 2034-11-05 | U-3419 | |
| 9700553 | 2034-11-05 | U-3419 | |
| 9707191 | 2034-11-05 | U-3419 | |
| 9763932 | 2034-11-05 | U-3419 | |
| 9861595 | 2034-11-05 | U-3419 | |
| 9867819 | 2034-11-05 | U-3419 | |
| 9968568 | 2034-11-05 | U-3419 | |
| 10058518 | 2034-11-05 | U-3419 | |
| 10064857 | 2034-11-05 | U-3419 | |
| 10080727 | 2034-11-05 | U-3419 | |
| 10092560 | 2034-11-05 | U-3419 | |
| 10092561 | 2034-11-05 | U-3419 | |
| 10105327 | 2034-11-05 | U-3419 | |
| 10105361 | 2034-11-05 | U-3419 | |
| 10251879 | 2034-11-05 | U-3419 | |
| 10463634 | 2034-11-05 | U-3419 | |
| 10512643 | 2034-11-05 | U-3419 | |
| 10548857 | 2034-11-05 | U-3419 | |
| 10596167 | 2034-11-05 | U-3419 | |
| 10772850 | 2034-11-05 | U-3419 | |
| 10786469 | 2034-11-05 | U-3419 | |
| 10786496 | 2034-11-05 | U-3419 | |
| 10799497 | 2034-11-05 | U-3419 | |
| 10806710 | 2034-11-05 | U-3419 | |
| 10864209 | 2034-11-05 | U-3419 | |
| 10874663 | 2034-11-05 | U-3419 | |
| 10874664 | 2034-11-05 | U-3419 | |
| 10874665 | 2034-11-05 | U-3419 | |
| 10881624 | 2034-11-05 | U-3419 | |
| 10881657 | 2034-11-05 | U-3419 | |
| 10894046 | 2034-11-05 | U-3419 | |
| 10894047 | 2034-11-05 | U-3419 | |
| 10898453 | 2034-11-05 | U-3419 | |
| 10933034 | 2034-11-05 | U-3419 | |
| 10945973 | 2034-11-05 | U-3419 | |
| 10966941 | 2034-11-05 | U-3419 | |
| 10966974 | 2034-11-05 | U-3419 | |
| 11020389 | 2034-11-05 | U-3419 | |
| 11058648 | 2034-11-05 | U-3419 | |
| 11090300 | 2034-11-05 | U-3419 | |
| 11096937 | 2034-11-05 | U-3419 | |
| 11123343 | 2034-11-05 | U-3419 | |
| 11129826 | 2034-11-05 | U-3419 | |
| 11141388 | 2034-11-05 | U-3419 | |
| 11141416 | 2034-11-05 | U-3419 | |
| 11147808 | 2034-11-05 | U-3419 | |
| 11185515 | 2034-11-05 | U-3419 | |
| 11191739 | 2034-11-05 | DP | U-3419 |
| 11197839 | 2034-11-05 | DP | U-3419 |
| 11207281 | 2034-11-05 | U-3419 | |
| 11213521 | 2034-11-05 | U-3419 | |
| 11229640 | 2034-11-05 | U-3419 | |
| 11234946 | 2034-11-05 | U-3419 | |
| 11253491 | 2034-11-05 | U-3419 | |
| 11253492 | 2034-11-05 | U-3419 | |
| 11273133 | 2034-11-05 | U-3419 | |
| 11273134 | 2034-11-05 | U-3419 | |
| 11285118 | 2034-11-05 | U-3419 | |
| 11285146 | 2034-11-05 | U-3419 | |
| 11291638 | 2034-11-05 | U-3419 | |
| 11291665 | 2034-11-05 | U-3419 | |
| 11298351 | 2034-11-05 | U-3419 | |
| 11298352 | 2034-11-05 | U-3419 | |
| 11311534 | 2034-11-05 | U-3419 | |
| 11344544 | 2034-11-05 | U-3419 | |
| 11357744 | 2034-11-05 | U-3419 | |
| 11364233 | 2034-11-05 | U-3419 | |
| 11382874 | 2034-11-05 | U-3419 | |
| 11419867 | 2034-11-05 | U-3419 | |
| 11426370 | 2034-11-05 | U-3419 | |
| 11426401 | 2034-11-05 | U-3419 | |
| 11433067 | 2034-11-05 | DP | U-3419 |
| 11439636 | 2034-11-05 | U-3419 | |
| 11478468 | 2034-11-05 | U-3419 | |
| 11497721 | 2034-11-05 | U-3419 | |
| 11510918 | 2034-11-05 | U-3419 | |
| 11517542 | 2034-11-05 | U-3419 | |
| 11517543 | 2034-11-05 | U-3419 | |
| 11524007 | 2034-11-05 | U-3419 | |
| 11524008 | 2034-11-05 | U-3419 | |
| 11534414 | 2034-11-05 | DP | U-3419 |
| 11541021 | 2034-11-05 | U-3419 | |
| 11541048 | 2034-11-05 | U-3419 | |
| 11596627 | 2034-11-05 | U-3419 | |
| 11617728 | 2034-11-05 | U-3419 | |
| 11617747 | 2034-11-05 | U-3563 | |
| 11779579 | 2034-11-05 | U-3419 | |
| 8569328 | 2033-10-29 | DP | U-3419 |
| Bupropion Hydrochloride / Naltrexone Hydrochloride, Contrave, Nalpropion | |||
| 10231964 | 2034-07-02 | U-1583 | |
| 10828294 | 2034-07-02 | U-1583 | |
| 10835527 | 2034-07-02 | U-1583 | |
| 9633575 | 2033-06-25 | U-1583 | |
| 10403170 | 2033-06-05 | U-1583 | |
| 11139056 | 2033-06-05 | U-1583 | |
| 9248123 | 2032-01-13 | U-1808 | |
| 11033543 | 2031-01-10 | U-1583 | |
| 8916195 | 2030-02-02 | U-1639 | |
| 11324741 | 2029-05-29 | U-1583 | |
| 8088786 | 2029-02-03 | DP | |
| 8318788 | 2027-11-08 | U-1584 | |
| 8722085 | 2027-11-08 | U-1585 | |
| 9125868 | 2027-11-08 | U-1585 | |
| 10307376 | 2027-11-08 | U-1585 | |
| 9107837 | 2027-06-04 | U-1639 | |
| 7375111 | 2025-03-26 | DP | |
| 7462626 | 2024-07-20 | U-1583 | |
| 8815889 | 2024-07-20 | U-1586 | |
| 11278544 | 2024-04-21 | U-1583 | |
| Bupropion Hydrochloride, Forfivo Xl, Twi Pharms | |||
| 7674479 | 2027-06-25 | DP | |
| Bupropion Hydrobromide, Aplenzin, Bausch | |||
| 7241805 | 2026-06-27 | DP | |
| 7569610 | 2026-06-27 | U-997 | |
| 7572935 | 2026-06-27 | DP | |
| 7585897 | 2026-06-27 | DP | |
| 7645802 | 2026-06-27 | DP | |
| 7649019 | 2026-06-27 | DP | |
| 7662407 | 2026-06-27 | DP | |
| 7671094 | 2026-06-27 | DP | |
Code | Description |
|---|---|
| S0106 | Bupropion hcl sustained release tablet, 150 mg, per bottle of 60 tablets |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Obesity | D009765 | EFO_0001073 | E66.9 | — | 5 | 6 | 2 | — | 13 |
| Cardiovascular diseases | D002318 | EFO_0000319 | I98 | — | — | — | 1 | — | 1 |
Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Overweight | D050177 | — | E66.3 | — | 3 | 6 | — | — | 9 |
| Body weight | D001835 | EFO_0004338 | — | — | — | 1 | — | — | 1 |
| Type 2 diabetes mellitus | D003924 | EFO_0001360 | E11 | — | — | 1 | — | — | 1 |
| Diabetes mellitus | D003920 | EFO_0000400 | E08-E13 | — | — | 1 | — | — | 1 |
Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Depression | D003863 | — | F33.9 | — | 1 | — | — | — | 1 |
| Depressive disorder | D003866 | EFO_1002014 | F32.A | — | 1 | — | — | — | 1 |
| Tobacco use disorder | D014029 | — | F17 | — | 1 | — | — | — | 1 |
Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Healthy volunteers/patients | — | — | — | 2 | — | — | — | — | 2 |
| Drug common name | Bupropion |
| INN | bupropion |
| Description | Bupropion is an aromatic ketone that is propiophenone carrying a tert-butylamino group at position 2 and a chloro substituent at position 3 on the phenyl ring. It has a role as an antidepressant, an environmental contaminant and a xenobiotic. It is a secondary amino compound, a member of monochlorobenzenes and an aromatic ketone. |
| Classification | Small molecule |
| Drug class | NDRI antidepressants |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1 |
| PDB | — |
| CAS-ID | 34841-39-9 |
| RxCUI | — |
| ChEMBL ID | CHEMBL894 |
| ChEBI ID | 3219 |
| PubChem CID | 444 |
| DrugBank | DB01156 |
| UNII ID | 01ZG3TPX31 (ChemIDplus, GSRS) |






