
Therapeutic Area | MeSH |
|---|---|
| nervous system diseases | D009422 |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| TREXIMET | Currax Pharmaceuticals | N-021926 RX | 2008-04-15 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| imitrex | New Drug Application | 2025-12-09 |
| migraine pack | ANDA | 2017-01-13 |
| migranow | unapproved drug other | 2024-12-13 |
| onzetra xsail | New Drug Application | 2024-04-18 |
| sumansetron | unapproved drug other | 2023-01-11 |
| sumatriptan | ANDA | 2026-01-26 |
| sumatriptan and naproxen sodium | ANDA | 2025-11-20 |
| sumatriptan succinate | ANDA | 2026-01-08 |
| sumatriptan succinate and naproxen sodium | NDA authorized generic | 2024-12-24 |
| sumavel dosepro | New Drug Application | 2014-02-07 |
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Sumatriptan Succinate, Zembrace Symtouch, Tonix Meds | |||
| 10537554 | 2036-01-29 | U-72 | |
| 11364224 | 2036-01-29 | U-72 | |
| Sumatriptan Succinate, Onzetra Xsail, Currax | |||
| 10076614 | 2034-10-20 | DP | |
| 10478574 | 2033-11-04 | U-2404 | |
| 8978647 | 2030-12-06 | DP | |
| 9649456 | 2030-10-21 | DP | U-1719, U-2010, U-2011 |
| 8899229 | 2030-08-18 | DP | |
| 8550073 | 2029-10-22 | DP | |
| 10076615 | 2029-07-30 | U-2010, U-2011, U-2404 | |
| 10722667 | 2028-12-30 | DP | |
| 8875704 | 2028-04-07 | DP | U-1809 |
| 10398859 | 2027-12-19 | DP | |
| 10124132 | 2027-03-06 | DP | U-1719, U-2010, U-2011 |
| 11571531 | 2026-02-23 | U-1809 | |
| 8590530 | 2025-09-15 | DP | U-1809 |
| 9108015 | 2025-09-15 | DP | |
| 7975690 | 2025-08-18 | DP | U-1809 |
| 9119932 | 2024-04-23 | DP | |
| Sumatriptan Succinate, Zecuity, Teva Branded Pharm | |||
| 9327114 | 2032-10-08 | DP | U-1328 |
| 8983594 | 2030-11-19 | DP | U-1328 |
| 8366600 | 2029-04-21 | U-1327 | |
| 9272137 | 2027-09-07 | DP | |
| 7973058 | 2027-04-12 | U-1328 | |
| 8155737 | 2027-04-12 | U-1328 | |
| 8470853 | 2027-04-12 | U-1328 | |
| 8597272 | 2027-04-12 | DP | |
| 9427578 | 2027-04-12 | DP | U-1328 |
| Sumatriptan, Tosymra, Tonix Meds | |||
| 9211282 | 2031-07-19 | DP | U-1719 |
| 9610280 | 2030-06-16 | DP | U-1719 |
| 9974770 | 2030-06-16 | DP | U-1719 |
| 10603305 | 2030-06-16 | DP | U-1719 |
| 11337962 | 2030-06-16 | DP | U-1719 |
| 8268791 | 2026-05-09 | DP | |
| 8440631 | 2026-05-09 | DP | U-1719 |
| 9283280 | 2026-05-09 | DP | |
| Sumatriptan Succinate, Alsuma, Meridian Medcl | |||
| 7811254 | 2027-08-26 | DP | U-1083 |
| Sumatriptan Succinate, Sumavel Dosepro, Endo Ventures Ltd | |||
| 7776007 | 2026-11-22 | DP | |
| 7901385 | 2026-07-31 | DP | |
| 8287489 | 2024-12-06 | DP | |
| Naproxen Sodium / Sumatriptan Succinate, Treximet, Currax | |||
| 7332183 | 2025-10-02 | DP | U-867, U-1719 |
Code | Description |
|---|---|
| J3030 | Injection, sumatriptan succinate, 6 mg (code may be used for medicare when drug administered under the direct supervision of a physician, not for use when drug is self administered) |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Healthy volunteers/patients | — | — | — | 2 | — | — | — | — | 2 |
| Drug common name | Sumatriptan |
| INN | sumatriptan |
| Description | Sumatriptan is a sulfonamide that consists of N,N-dimethyltryptamine bearing an additional (N-methylsulfamoyl)methyl substituent at position 5. Selective agonist for a vascular 5-HT1 receptor subtype (probably a member of the 5-HT1D family). Used (in the form of its succinate salt) for the acute treatment of migraine with or without aura in adults. It has a role as a serotonergic agonist and a vasoconstrictor agent. It is a sulfonamide and a member of tryptamines. It is functionally related to a N,N-dimethyltryptamine. It is a conjugate acid of a sumatriptan(1+). |
| Classification | Small molecule |
| Drug class | antimigraine agents (5-HT1 receptor agonists); sumatriptan derivatives |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | CNS(=O)(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1 |
| PDB | — |
| CAS-ID | 103628-46-2 |
| RxCUI | — |
| ChEMBL ID | CHEMBL128 |
| ChEBI ID | 10650 |
| PubChem CID | 5358 |
| DrugBank | DB00669 |
| UNII ID | 8R78F6L9VO (ChemIDplus, GSRS) |













