Therapeutic Area | MeSH |
---|---|
neoplasms | D009369 |
signs and symptoms pathological conditions | D013568 |
Tradename | Company | Number | Date | Products |
---|---|---|---|---|
VARUBI | TerSera Therapeutics | N-206500 RX | 2015-09-01 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
---|---|---|
varubi | New Drug Application | 2020-08-19 |
Indication | Ontology | MeSH | ICD-10 |
---|---|---|---|
vomiting | HP_0002013 | D014839 | R11.1 |
nausea | HP_0002018 | D009325 | R11.0 |
Indication | MeSH | Ontology | ICD-10 | PhĀ 1 | PhĀ 2 | PhĀ 3 | PhĀ 4 | Other | Total |
---|---|---|---|---|---|---|---|---|---|
Vomiting | D014839 | HP_0002013 | R11.1 | 3 | 4 | 3 | ā | ā | 10 |
Nausea | D009325 | HP_0002018 | R11.0 | ā | 3 | 3 | ā | ā | 6 |
Indication | MeSH | Ontology | ICD-10 | PhĀ 1 | PhĀ 2 | PhĀ 3 | PhĀ 4 | Other | Total |
---|---|---|---|---|---|---|---|---|---|
Sarcoma | D012509 | ā | ā | ā | 1 | ā | ā | ā | 1 |
Germ cell and embryonal neoplasms | D009373 | ā | ā | ā | 1 | ā | ā | ā | 1 |
Glioma | D005910 | EFO_0000520 | ā | ā | 1 | ā | ā | ā | 1 |
Cough | D003371 | HP_0012735 | R05 | ā | 1 | ā | ā | ā | 1 |
Postoperative nausea and vomiting | D020250 | EFO_0004888 | ā | ā | 1 | ā | ā | ā | 1 |
Drug common name | Rolapitant |
INN | rolapitant |
Description | Rolapitant is an azaspiro compound that is 1,7-diazaspiro[4.5]decan-2-one carrying additional phenyl and 1-{[3,5-bis(trifluoromethyl)phenyl]ethoxy}methyl substituents at position 8. Used (in the form of the hydrochloride hydrate) for the prevention of delayed nausea and vomiting associated with initial and repeat courses of emetogenic cancer chemotherapy. It has a role as an antiemetic and a neurokinin-1 receptor antagonist. It is an ether, an azaspiro compound, a member of pyrrolidin-2-ones, a member of piperidines and an organofluorine compound. It is a conjugate base of a rolapitant(1+). |
Classification | Small molecule |
Drug class | tachykinin (neurokinin) receptor antagonists: NK1 receptor antagonists |
Image (chem structure or protein) | |
Structure (InChI/SMILES or Protein Sequence) | C[C@@H](OC[C@@]1(c2ccccc2)CC[C@]2(CCC(=O)N2)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
PDB | ā |
CAS-ID | 552292-08-7 |
RxCUI | ā |
ChEMBL ID | CHEMBL3707331 |
ChEBI ID | ā |
PubChem CID | 10311306 |
DrugBank | DB09291 |
UNII ID | NLE429IZUC (ChemIDplus, GSRS) |