
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| GALAFOLD | Amicus Therapeutics | N-208623 RX | 2018-08-10 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| galafold | New Drug Application | 2025-08-28 |
Indication | Ontology | MeSH | ICD-10 |
|---|---|---|---|
| fabry disease | Orphanet_324 | D000795 | E75.21 |
Expiration | Code | ||
|---|---|---|---|
MIGALASTAT HYDROCHLORIDE, GALAFOLD, AMICUS THERAP US | |||
| 2025-08-10 | ODE-205 | ||
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Migalastat Hydrochloride, Galafold, Amicus Therap Us | |||
| 11833164 | 2042-01-11 | U-2371 | |
| 11633388 | 2039-03-25 | U-2371 | |
| 11622962 | 2039-03-17 | DP | |
| 11642334 | 2039-02-20 | U-2371 | |
| 11826360 | 2039-02-16 | DP | |
| 11357784 | 2039-02-06 | U-2371 | |
| 11903938 | 2038-08-17 | DP | U-2371 |
| 10251873 | 2038-05-30 | U-2371 | |
| 10471053 | 2038-05-30 | U-2371 | |
| 10792278 | 2038-05-30 | U-2371 | |
| 10792279 | 2038-05-30 | U-2371 | |
| 10799491 | 2038-05-30 | U-2371 | |
| 10806727 | 2038-05-30 | U-2371 | |
| 10849889 | 2038-05-30 | U-2371 | |
| 10849890 | 2038-05-30 | U-2371 | |
| 10857141 | 2038-05-30 | U-2371 | |
| 10857142 | 2038-05-30 | U-2371 | |
| 10874655 | 2038-05-30 | U-2371 | |
| 10874656 | 2038-05-30 | U-2371 | |
| 10874657 | 2038-05-30 | U-2371 | |
| 11278536 | 2038-05-30 | U-2371 | |
| 11278537 | 2038-05-30 | U-2371 | |
| 11278538 | 2038-05-30 | U-2371 | |
| 11278539 | 2038-05-30 | U-2371 | |
| 11278540 | 2038-05-30 | U-2371 | |
| 11304940 | 2038-05-30 | DP | |
| 11357761 | 2038-05-30 | U-2371 | |
| 11357762 | 2038-05-30 | U-2371 | |
| 11357763 | 2038-05-30 | U-2371 | |
| 11357764 | 2038-05-30 | DP | |
| 11357765 | 2038-05-30 | DP | |
| 11376244 | 2038-05-30 | DP | |
| 11389436 | 2038-05-30 | U-2371 | |
| 11389437 | 2038-05-30 | U-2371 | |
| 11426396 | 2038-05-30 | DP | |
| 11458128 | 2038-05-30 | U-2371 | |
| 11612593 | 2038-05-30 | DP | |
| 11612594 | 2038-05-30 | DP | |
| 11633387 | 2038-05-30 | DP | |
| 11666564 | 2038-05-30 | U-2371 | |
| 11786516 | 2038-05-30 | DP | |
| 11813255 | 2038-05-30 | U-2371 | |
| 10076514 | 2037-03-15 | U-2371 | |
| 11234972 | 2037-03-15 | U-2371 | |
| RE48608 | 2029-02-12 | U-2371 | |
| 8592362 | 2029-02-12 | U-2371 | |
| 9095584 | 2029-02-12 | U-2371 | |
| 10813921 | 2029-02-12 | U-2371 | |
| 9999618 | 2028-04-28 | U-2372, U-2373 | |
| 10525045 | 2028-04-28 | U-2371 | |
| 10925866 | 2028-04-28 | U-2371 | |
| 11033538 | 2028-04-28 | U-2371 | |
| 9000011 | 2027-05-16 | U-2371 | |
| 9480682 | 2027-05-16 | U-2371 | |
| 9987263 | 2027-05-16 | U-2371 | |
| 10383864 | 2027-05-16 | U-2371 | |
| 10406143 | 2027-05-16 | U-2371 | |
| 11241422 | 2027-05-16 | U-2371 | |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Fabry disease | D000795 | Orphanet_324 | E75.21 | 5 | 6 | 8 | — | 7 | 26 |
| Lysosomal storage diseases | D016464 | — | — | 1 | — | 1 | — | — | 2 |
| Chronic kidney failure | D007676 | EFO_0003884 | N18.6 | — | — | 1 | — | — | 1 |
| Kidney diseases | D007674 | EFO_0003086 | N08 | — | — | 1 | — | — | 1 |
| Renal insufficiency | D051437 | — | N19 | — | — | 1 | — | — | 1 |
Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Heart diseases | D006331 | EFO_0003777 | I51.9 | — | — | — | — | 1 | 1 |
| Drug common name | Migalastat |
| INN | migalastat |
| Description | Migalastat is a member of piperidines. |
| Classification | Small molecule |
| Drug class | enzyme inhibitors |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | OC[C@H]1NC[C@H](O)[C@@H](O)[C@H]1O |
| PDB | — |
| CAS-ID | 108147-54-2 |
| RxCUI | — |
| ChEMBL ID | CHEMBL110458 |
| ChEBI ID | — |
| PubChem CID | 176077 |
| DrugBank | DB05018 |
| UNII ID | C4XNY919FW (ChemIDplus, GSRS) |



