
Therapeutic Area | MeSH |
|---|---|
| infections | D007239 |
| skin and connective tissue diseases | D017437 |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| JUBLIA | Bausch Health Companies | N-203567 RX | 2014-06-06 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| jublia | New Drug Application | 2025-07-01 |
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Efinaconazole, Jublia, Bausch | |||
| 10478601 | 2035-04-25 | DP | U-2721 |
| 9662394 | 2034-10-02 | DP | |
| 10342875 | 2034-10-02 | DP | U-2720 |
| 10828293 | 2034-10-02 | U-2720 | |
| 10864274 | 2034-10-02 | U-2720 | |
| 11654139 | 2034-10-02 | U-1969 | |
| 8486978 | 2030-10-24 | DP | |
| 9302009 | 2030-10-24 | DP | |
| 8039494 | 2030-07-08 | U-281 | |
| 9861698 | 2030-07-08 | DP | |
| 10105444 | 2030-07-08 | DP | |
| 9566272 | 2028-01-03 | U-1969 | |
| 9877955 | 2028-01-03 | U-1969 | |
| 10512640 | 2028-01-03 | U-1969 | |
| 10828369 | 2028-01-03 | DP | |
| 11213519 | 2028-01-03 | U-2720 | |
| 11872218 | 2028-01-03 | U-1969 | |
| 7214506 | 2026-02-22 | U-281 | |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Onychomycosis | D014009 | — | B35.1 | — | 1 | 3 | 4 | — | 8 |
| Tinea | D014005 | EFO_0007510 | B35.4 | — | — | — | 1 | — | 1 |
| Drug common name | Efinaconazole |
| INN | efinaconazole |
| Description | Efinaconazole is a member of the class of triazoles that is butan-2-ol which is substituted at positions 1, 2, and 3 by 1,2,4-triazol-1-yl, 2,4-difluorophenyl, and 4-methylenepiperidin-1-yl groups, respectively (the 2R,3R stereoisomer). It is an antifungal drug used for the topical treatment of onychomycosis (a nail infection caused mainly by dermatophytes). It has a role as an EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor. It is an organofluorine compound, an olefinic compound, a member of piperidines, a tertiary alcohol, a tertiary amino compound, a conazole antifungal drug and a triazole antifungal drug. |
| Classification | Small molecule |
| Drug class | systemic antifungals (miconazole type); Fc fusion protein |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | C=C1CCN([C@H](C)[C@](O)(Cn2cncn2)c2ccc(F)cc2F)CC1 |
| PDB | — |
| CAS-ID | 164650-44-6 |
| RxCUI | — |
| ChEMBL ID | CHEMBL2103877 |
| ChEBI ID | 82718 |
| PubChem CID | 489181 |
| DrugBank | DB09040 |
| UNII ID | J82SB7FXWB (ChemIDplus, GSRS) |

