
Therapeutic Area | MeSH |
|---|---|
| infections | D007239 |
| respiratory tract diseases | D012140 |
| urogenital diseases | D000091642 |
| Drug common name | Cyclacillin |
| INN | ciclacillin |
| Description | Cyclacillin is a penicillin. It has a role as an antibacterial drug. |
| Classification | Small molecule |
| Drug class | penicillins |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | CC1(C)S[C@@H]2[C@H](NC(=O)C3(N)CCCCC3)C(=O)N2[C@H]1C(=O)O |
| PDB | — |
| CAS-ID | 3485-14-1 |
| RxCUI | — |
| ChEMBL ID | CHEMBL1200356 |
| ChEBI ID | 31444 |
| PubChem CID | 19003 |
| DrugBank | DB01000 |
| UNII ID | 72ZJ154X86 (ChemIDplus, GSRS) |
