Therapeutic Area | MeSH |
---|---|
eye diseases | D005128 |
cardiovascular diseases | D002318 |
Brand Name | Status | Last Update |
---|---|---|
carteolol hydrochloride | ANDA | 2021-08-31 |
ocupress | 2006-09-19 |
Indication | Ontology | MeSH | ICD-10 |
---|---|---|---|
hypertension | EFO_0000537 | D006973 | I10 |
open-angle glaucoma | EFO_0004190 | D005902 | H40.1 |
Indication | MeSH | Ontology | ICD-10 | PhĀ 1 | PhĀ 2 | PhĀ 3 | PhĀ 4 | Other | Total |
---|---|---|---|---|---|---|---|---|---|
Ocular hypertension | D009798 | EFO_1001069 | H40.0 | 1 | ā | 3 | 1 | ā | 5 |
Glaucoma | D005901 | EFO_0000516 | H40 | 1 | ā | 3 | 1 | ā | 5 |
Hypertension | D006973 | EFO_0000537 | I10 | ā | ā | 3 | 1 | ā | 4 |
Indication | MeSH | Ontology | ICD-10 | PhĀ 1 | PhĀ 2 | PhĀ 3 | PhĀ 4 | Other | Total |
---|---|---|---|---|---|---|---|---|---|
Open-angle glaucoma | D005902 | EFO_0004190 | H40.1 | ā | ā | 1 | ā | ā | 1 |
Indication | MeSH | Ontology | ICD-10 | PhĀ 1 | PhĀ 2 | PhĀ 3 | PhĀ 4 | Other | Total |
---|---|---|---|---|---|---|---|---|---|
Hypersensitivity | D006967 | EFO_0003785 | T78.40 | ā | ā | ā | ā | 1 | 1 |
Drug common name | Carteolol |
INN | carteolol |
Description | Carteolol is a quinolone and a secondary alcohol. It has a role as a beta-adrenergic antagonist, an antihypertensive agent, an antiglaucoma drug, an anti-arrhythmia drug and a sympatholytic agent. It is a conjugate base of a carteolol(1+). |
Classification | Small molecule |
Drug class | beta-blockers (propranolol type) |
Image (chem structure or protein) | ![]() |
Structure (InChI/SMILES or Protein Sequence) | CC(C)(C)NCC(O)COc1cccc2c1CCC(=O)N2 |
PDB | ā |
CAS-ID | 51781-06-7 |
RxCUI | ā |
ChEMBL ID | CHEMBL839 |
ChEBI ID | 3437 |
PubChem CID | 2583 |
DrugBank | DB00521 |
UNII ID | 8NF31401XG (ChemIDplus, GSRS) |