
Therapeutic Area | MeSH |
|---|---|
| eye diseases | D005128 |
| skin and connective tissue diseases | D017437 |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| ALPHAGAN P | AbbVie | N-021770 RX | 2005-08-19 | 1 products, RLD, RS |
| ALPHAGAN P | AbbVie | N-021262 RX | 2001-03-16 | 1 products, RLD, RS |
| LUMIFY | Bausch Health Companies | N-208144 OTC | 2017-12-22 | 1 products, RLD, RS |
| LUMIFY PRESERVATIVE FREE | Bausch Health Companies | N-218424 OTC | 2024-04-19 | 1 products, RLD, RS |
| MIRVASO | Galderma | N-204708 RX | 2013-08-23 | 1 products, RLD, RS |
| QOLIANA | Sandoz | N-021764 RX | 2006-05-22 | 1 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| SIMBRINZA | Alcon Research | N-204251 RX | 2013-04-19 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| alphagan p | New Drug Application | 2025-09-18 |
| brim-dor pf | unapproved drug other | 2018-05-08 |
| brimonidine | ANDA | 2025-10-07 |
| brimonidine tartrate | ANDA | 2026-03-12 |
| brimonidine tartrate 0.25% / ivermectin 1% / metronidazole 1% / niacinamide 4% | unapproved drug other | 2019-05-15 |
| brimonidine tartrate 0.25% / potassium azeloyl diglycinate 8% | unapproved drug other | 2019-05-15 |
| brimonidine tartrate and timolol maleate | ANDA | 2025-06-27 |
| brimonidine tartrate ophthalmic solution, 0.15% | ANDA | 2023-07-06 |
| brimonidine tartrate/timolol maleate | ANDA | 2025-01-22 |
| brimonidine tartrate/timolol maleate ophthalmic solution | ANDA | 2025-09-16 |
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Brimonidine Tartrate, Mirvaso, Galderma Labs Lp | |||
| 8053427 | 2031-06-13 | DP | U-1428 |
| 8163725 | 2031-06-13 | DP | |
| 10201517 | 2031-06-13 | DP | |
| 8513247 | 2031-03-25 | DP | U-1428 |
| 8513249 | 2031-03-25 | DP | U-1428 |
| 9861631 | 2031-03-25 | U-1428 | |
| 9861632 | 2031-03-25 | U-1428 | |
| 7439241 | 2025-08-25 | U-1428 | |
| 8231885 | 2025-05-24 | DP | |
| 8410102 | 2025-05-24 | U-1428 | |
| 8426410 | 2025-05-24 | U-1428 | |
| 8859551 | 2024-05-25 | U-1428 | |
| Brimonidine Tartrate / Brinzolamide, Simbrinza, Alcon Labs Inc | |||
| 9044484 | 2030-10-30 | DP | |
| 9421265 | 2030-06-17 | DP | |
| Brimonidine Tartrate, Lumify, Bausch And Lomb Inc | |||
| 8293742 | 2030-07-14 | U-2222 | |
| 9259425 | 2030-07-14 | U-2222 | |
| 11596600 | 2029-07-27 | U-2222 | |
| 11833245 | 2029-07-27 | U-2222 | |
| Brimonidine Tartrate, Qoliana, Sandoz | |||
| 7265117 | 2025-08-19 | DP | |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Ovarian neoplasms | D010051 | EFO_0003893 | C56 | — | 1 | — | — | — | 1 |
| Drug common name | Brimonidine |
| INN | brimonidine |
| Description | Brimonidine is a quinoxaline derivative, a secondary amine and a member of imidazoles. It has a role as an adrenergic agonist, an antihypertensive agent and an alpha-adrenergic agonist. |
| Classification | Small molecule |
| Drug class | — |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | Brc1c(NC2=NCCN2)ccc2nccnc12 |
| PDB | — |
| CAS-ID | 59803-98-4 |
| RxCUI | — |
| ChEMBL ID | CHEMBL844 |
| ChEBI ID | 3175 |
| PubChem CID | 2435 |
| DrugBank | DB00484 |
| UNII ID | E6GNX3HHTE (ChemIDplus, GSRS) |











