
Therapeutic Area | MeSH |
|---|---|
| respiratory tract diseases | D012140 |
| immune system diseases | D007154 |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| COMBIVENT RESPIMAT | Boehringer Ingelheim | N-021747 RX | 2011-10-07 | 1 products, RLD, RS |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| VENTOLIN | GSK | N-018473 DISCN | 1982-01-01 | 1 products |
| PROVENTIL | Merck & Co | N-017559 DISCN | 1982-01-01 | 1 products |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| AIRSUPRA | AstraZeneca | N-214070 RX | 2023-01-10 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| airsupra | New Drug Application | 2025-09-18 |
| albuterol | ANDA | 2026-04-14 |
| albuterol sulate | NDA authorized generic | 2026-01-30 |
| albuterol sulfate | ANDA | 2026-08-06 |
| albuterol sulfate hfa | NDA authorized generic | 2023-02-06 |
| albuterol sulfate inhalation | ANDA | 2024-12-20 |
| albuterol sulfate inhalation solution | ANDA | 2026-04-30 |
| albuterol sulfate inhalation solution, 0.5% | ANDA | 2026-04-30 |
| basic dental emergency kit | unapproved drug other | 2025-10-16 |
| combivent respimat | New Drug Application | 2025-12-01 |
Expiration | Code | ||
|---|---|---|---|
ALBUTEROL SULFATE / BUDESONIDE, AIRSUPRA, ASTRAZENECA | |||
| 2026-01-10 | NP | ||
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Albuterol Sulfate, Proair Digihaler, Teva Branded Pharm | |||
| 11266796 | 2041-02-22 | DP | |
| 11173259 | 2040-07-06 | DP | |
| 11464923 | 2040-06-19 | DP | |
| 11439777 | 2040-05-24 | DP | |
| 11344685 | 2039-09-26 | DP | |
| 11000653 | 2038-12-18 | DP | |
| 11357935 | 2038-09-24 | DP | |
| 11351317 | 2038-02-10 | DP | |
| 10569034 | 2036-08-16 | DP | |
| 10918816 | 2035-12-14 | DP | |
| 9782550 | 2035-08-28 | DP | |
| 9782551 | 2035-08-28 | DP | |
| 8978966 | 2032-01-13 | DP | |
| 9216260 | 2031-06-28 | DP | |
| 9731087 | 2031-05-18 | DP | |
| 10022510 | 2031-05-18 | DP | |
| 10124131 | 2031-05-18 | DP | |
| 8651103 | 2028-03-26 | DP | |
| 9463288 | 2025-05-19 | DP | |
| 10765820 | 2025-05-19 | DP | |
| Albuterol Sulfate, Proair Hfa, Teva Branded Pharm | |||
| 10561808 | 2032-01-01 | DP | |
| 9463289 | 2031-05-18 | DP | |
| 9808587 | 2031-05-18 | DP | |
| 10022509 | 2031-05-18 | DP | |
| 10086156 | 2031-05-18 | DP | |
| 10695512 | 2031-05-18 | DP | |
| 11395889 | 2031-05-18 | DP | |
| 8132712 | 2028-09-07 | DP | |
| Albuterol Sulfate / Ipratropium Bromide, Combivent Respimat, Boehringer Ingelheim | |||
| 8733341 | 2030-10-16 | DP | |
| 7837235 | 2028-03-13 | DP | |
| 9027967 | 2027-03-31 | DP | |
| 7396341 | 2026-10-10 | DP | |
| Albuterol Sulfate / Budesonide, Airsupra, Astrazeneca | |||
| 9415009 | 2030-05-28 | U-3509 | |
Code | Description |
|---|---|
| J7607 | Levalbuterol, inhalation solution, compounded product, administered through dme, concentrated form, 0.5 mg |
| J7609 | Albuterol, inhalation solution, compounded product, administered through dme, unit dose, 1 mg |
| J7610 | Albuterol, inhalation solution, compounded product, administered through dme, concentrated form, 1 mg |
| J7611 | Albuterol, inhalation solution, fda-approved final product, non-compounded, administered through dme, concentrated form, 1 mg |
| J7612 | Levalbuterol, inhalation solution, fda-approved final product, non-compounded, administered through dme, concentrated form, 0.5 mg |
| J7613 | Albuterol, inhalation solution, fda-approved final product, non-compounded, administered through dme, unit dose, 1 mg |
| J7614 | Levalbuterol, inhalation solution, fda-approved final product, non-compounded, administered through dme, unit dose, 0.5 mg |
| J7615 | Levalbuterol, inhalation solution, compounded product, administered through dme, unit dose, 0.5 mg |
| J7620 | Albuterol, up to 2.5 mg and ipratropium bromide, up to 0.5 mg, fda-approved final product, non-compounded, administered through dme |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Asthma | D001249 | EFO_0000270 | J45 | — | — | 2 | — | — | 2 |
| Drug common name | Albuterol |
| INN | salbutamol |
| Description | Albuterol is a member of the class of phenylethanolamines that is 4-(2-amino-1-hydroxyethyl)-2-(hydroxymethyl)phenol having a tert-butyl group attached to the nirogen atom. It acts as a beta-adrenergic agonist used in the treatment of asthma and chronic obstructive pulmonary disease (COPD). It has a role as a bronchodilator agent, a beta-adrenergic agonist, an environmental contaminant and a xenobiotic. It is a member of phenylethanolamines, a secondary amino compound and a member of phenols. |
| Classification | Small molecule |
| Drug class | bronchodilators (phenethylamine derivatives) |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | CC(C)(C)NCC(O)c1ccc(O)c(CO)c1 |
| PDB | — |
| CAS-ID | 18559-94-9 |
| RxCUI | — |
| ChEMBL ID | CHEMBL714 |
| ChEBI ID | 2549 |
| PubChem CID | 2083 |
| DrugBank | DB01001 |
| UNII ID | QF8SVZ843E (ChemIDplus, GSRS) |















