
Therapeutic Area | MeSH |
|---|---|
| skin and connective tissue diseases | D017437 |
Tradename | Company | Number | Date | Products |
|---|---|---|---|---|
| CABTREO | Bausch Health Companies | N-216632 RX | 2023-10-20 | 1 products, RLD, RS |
Brand Name | Status | Last Update |
|---|---|---|
| adapalene | ANDA | 2026-03-23 |
| adapalene 0.1% / benzoyl peroxide 2.5% / clindamycin 1% | unapproved drug other | 2020-06-03 |
| adapalene 0.1% / benzoyl peroxide 2.5% / niacinamide 4% | unapproved drug other | 2020-06-03 |
| adapalene 0.3% / benzoyl peroxide 2.5% / clindamycin 1% | unapproved drug other | 2020-06-03 |
| adapalene 0.3% / benzoyl peroxide 2.5% / niacinamide 4% | unapproved drug other | 2020-06-03 |
| adapalene 0.3% / niacinamide 4% | unapproved drug other | 2019-05-09 |
| adapalene and benzoyl peroxide | ANDA | 2026-11-23 |
| adapalene and benzoyl peroxide gel, 0.1%/2.5% | ANDA | 2025-09-30 |
| adapalene and benzoyl peroxide swab | unapproved drug other | 2020-12-22 |
| adapalene gel | ANDA | 2025-07-24 |
Expiration | Code | ||
|---|---|---|---|
ADAPALENE / BENZOYL PEROXIDE / CLINDAMYCIN PHOSPHATE, CABTREO, BAUSCH | |||
| 2026-10-20 | NP | ||
Patent | Expires | Flag | FDA Information |
|---|---|---|---|
| Adapalene / Benzoyl Peroxide / Clindamycin Phosphate, Cabtreo, Bausch | |||
| 11389467 | 2040-12-28 | DP | U-3713 |
| 8288434 | 2029-08-05 | DP | U-3713 |
| 9561208 | 2029-06-03 | DP | U-3713 |
| 10220049 | 2029-06-03 | DP | U-3713 |
| 10624918 | 2029-06-03 | U-3713 | |
| Adapalene, Differin, Galderma Labs Lp | |||
| 7998467 | 2028-05-31 | DP | U-1078 |
| 8435502 | 2026-09-15 | DP | U-1078 |
| 8709392 | 2026-09-15 | DP | U-1078 |
| 7579377 | 2025-02-23 | U-818 | |
| 7737181 | 2024-08-29 | DP | |
| Adapalene / Benzoyl Peroxide, Epiduo, Galderma Labs Lp | |||
| 8071644 | 2027-07-18 | DP | U-1078 |
| 8080537 | 2027-07-18 | U-1078 | |
| 8129362 | 2027-07-18 | U-1078 | |
| 7820186 | 2025-11-23 | DP | |
| 7964202 | 2024-09-01 | DP | U-1078 |

Indication | MeSH | Ontology | ICD-10 | Ph 1 | Ph 2 | Ph 3 | Ph 4 | Other | Total |
|---|---|---|---|---|---|---|---|---|---|
| Acne vulgaris | D000152 | EFO_0003894 | L70 | 1 | 1 | — | 3 | 1 | 6 |
| Drug common name | Adapalene |
| INN | adapalene |
| Description | Adapalene is a naphthoic acid that is CD437 in which the phenolic hydroxy group has been converted to its methyl ether. It has a role as a dermatologic drug, a non-steroidal anti-inflammatory drug and an EC 2.7.11.22 (cyclin-dependent kinase) inhibitor. It is a monocarboxylic acid, a member of adamantanes and a naphthoic acid. It is functionally related to a CD437. |
| Classification | Small molecule |
| Drug class | Retinoids |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | COc1ccc(-c2ccc3cc(C(=O)O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| PDB | — |
| CAS-ID | 106685-40-9 |
| RxCUI | — |
| ChEMBL ID | CHEMBL1265 |
| ChEBI ID | 31174 |
| PubChem CID | 60164 |
| DrugBank | DB00210 |
| UNII ID | 1L4806J2QF (ChemIDplus, GSRS) |











