
| Drug common name | Acetyldigitoxin |
| INN | acetyldigitoxin |
| Description | Acetyldigitoxin is a cardiac glycoside. It is an acetyl derivative of digitoxin, found in the leaves of Digitalis species. It is used to treat cardiac failure, particularly that associated with tachycardia.
|
| Classification | Small molecule |
| Drug class | fluoroquinolone derivatives, nonantibacterial indication (e.g., antineoplastic antibiotics) |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | CC(=O)O[C@H]1C[C@H](O[C@H]2[C@@H](O)C[C@H](O[C@H]3[C@@H](O)C[C@H](O[C@H]4CC[C@]5(C)[C@H]6CC[C@]7(C)[C@@H](C8=CC(=O)OC8)CC[C@]7(O)[C@@H]6CC[C@@H]5C4)O[C@@H]3C)O[C@@H]2C)O[C@H](C)[C@H]1O |
| PDB | — |
| CAS-ID | 7263-26-5 |
| RxCUI | — |
| ChEMBL ID | CHEMBL3545057 |
| ChEBI ID | 53773 |
| PubChem CID | 68949 |
| DrugBank | DB00511 |
| UNII ID | 0ZV4Q4L2FU (ChemIDplus, GSRS) |
